C11H13F2N3O2 — CID 83101424
4-(6-amino-2,3-difluorophenyl)morpholine-3-carboxamide (PubChem CID 83101424) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is 4-(6-amino-2,3-difluorophenyl)morpholine-3-carboxamide.
| Compound Name | 4-(6-amino-2,3-difluorophenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83101424 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-(6-amino-2,3-difluorophenyl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H13F2N3O2/c12-6-1-2-7(14)10(9(6)13)16-3-4-18-5-8(16)11(15)17/h1-2,8H,3-5,14H2,(H2,15,17) |
| InChIKey | VRIWRPFZLGINMU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|