C8H13ClN4O2 — CID 83101437
3-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2,2-dimethylpropanamide (PubChem CID 83101437) has the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. Its IUPAC name is 3-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 83101437 |
| Molecular Formula | C8H13ClN4O2 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2,2-dimethylpropanamide |
| SMILES | COc1n[nH]c(NC(=O)C(C)(C)CCl)n1 |
| InChI | InChI=1S/C8H13ClN4O2/c1-8(2,4-9)5(14)10-6-11-7(15-3)13-12-6/h4H2,1-3H3,(H2,10,11,12,13,14) |
| InChIKey | IRWMSPBERAAYDO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|