C11H15N5O4 — CID 83105439
4-(6-amino-5-nitro-2-pyridinyl)-N-methylmorpholine-3-carboxamide (PubChem CID 83105439) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(6-amino-5-nitro-2-pyridinyl)-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-(6-amino-5-nitro-2-pyridinyl)-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83105439 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-(6-amino-5-nitro-2-pyridinyl)-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1c1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C11H15N5O4/c1-13-11(17)8-6-20-5-4-15(8)9-3-2-7(16(18)19)10(12)14-9/h2-3,8H,4-6H2,1H3,(H2,12,14)(H,13,17) |
| InChIKey | DYZYSZOTKLUKBR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|