C13H17N3O4 — CID 83103492
3-amino-4-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid (PubChem CID 83103492) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-amino-4-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid.
| Compound Name | 3-amino-4-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 83103492 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-amino-4-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid |
| SMILES | CNC(=O)C1COCCN1c1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C13H17N3O4/c1-15-12(17)11-7-20-5-4-16(11)10-3-2-8(13(18)19)6-9(10)14/h2-3,6,11H,4-5,7,14H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | KQXKWSBCEJNFFK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|