C13H16FN3O4 — CID 83105182
2-amino-4-fluoro-5-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid (PubChem CID 83105182) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 83105182 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-amino-4-fluoro-5-[3-(methylcarbamoyl)morpholin-4-yl]benzoic acid |
| SMILES | CNC(=O)C1COCCN1c1cc(C(=O)O)c(N)cc1F |
| InChI | InChI=1S/C13H16FN3O4/c1-16-12(18)11-6-21-3-2-17(11)10-4-7(13(19)20)9(15)5-8(10)14/h4-5,11H,2-3,6,15H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | ZVSGWXNJTHUKDZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|