C13H16ClN3O2S — CID 83098502
4-(2-carbamothioyl-4-chlorophenyl)-N-methylmorpholine-3-carboxamide (PubChem CID 83098502) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 4-(2-carbamothioyl-4-chlorophenyl)-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-(2-carbamothioyl-4-chlorophenyl)-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098502 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-(2-carbamothioyl-4-chlorophenyl)-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1c1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C13H16ClN3O2S/c1-16-13(18)11-7-19-5-4-17(11)10-3-2-8(14)6-9(10)12(15)20/h2-3,6,11H,4-5,7H2,1H3,(H2,15,20)(H,16,18) |
| InChIKey | NLVVYWONRCWRHG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|