C14H18N4O2S — CID 83097189
4-(6-amino-2-methyl-1,3-benzothiazol-5-yl)-N-methylmorpholine-3-carboxamide (PubChem CID 83097189) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-(6-amino-2-methyl-1,3-benzothiazol-5-yl)-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-(6-amino-2-methyl-1,3-benzothiazol-5-yl)-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83097189 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-(6-amino-2-methyl-1,3-benzothiazol-5-yl)-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1c1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C14H18N4O2S/c1-8-17-10-6-11(9(15)5-13(10)21-8)18-3-4-20-7-12(18)14(19)16-2/h5-6,12H,3-4,7,15H2,1-2H3,(H,16,19) |
| InChIKey | KDZAPQAIUKYISB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|