C13H18BrN3O2 — CID 83106146
4-[4-(aminomethyl)-2-bromophenyl]-N-methylmorpholine-3-carboxamide (PubChem CID 83106146) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-2-bromophenyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[4-(aminomethyl)-2-bromophenyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83106146 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-[4-(aminomethyl)-2-bromophenyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1c1ccc(CN)cc1Br |
| InChI | InChI=1S/C13H18BrN3O2/c1-16-13(18)12-8-19-5-4-17(12)11-3-2-9(7-15)6-10(11)14/h2-3,6,12H,4-5,7-8,15H2,1H3,(H,16,18) |
| InChIKey | RGUFKPMNEQDDPY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |