About 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea
3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83107212) has the molecular formula C14H23N5O2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea |
| PubChem CID | 83107212 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccc(N)c(OCC2CC2)n1 |
| InChI | InChI=1S/C14H23N5O2/c1-19(2)14(20)17-8-7-16-12-6-5-11(15)13(18-12)21-9-10-3-4-10/h5-6,10H,3-4,7-9,15H2,1-2H3,(H,16,18)(H,17,20) |
| InChIKey | LNRPBZACOAFXMY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea (CID 83107212) is 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea is CN(C)C(=O)NCCNc1ccc(N)c(OCC2CC2)n1.
What is the InChIKey of 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea?
The InChIKey is LNRPBZACOAFXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O2/c1-19(2)14(20)17-8-7-16-12-6-5-11(15)13(18-12)21-9-10-3-4-10/h5-6,10H,3-4,7-9,15H2,1-2H3,(H,16,18)(H,17,20).
What are the key properties of 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea?
3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea has a molecular weight of 293.37 g/mol, XLogP of 1.14, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]ethyl]-1,1-dimethylurea is sourced from PubChem (CID 83107212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).