C16H27N3O2 — CID 106284306
1-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]-3-ethylpentan-2-ol (PubChem CID 106284306) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]-3-ethylpentan-2-ol.
| Compound Name | 1-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 106284306 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]amino]-3-ethylpentan-2-ol |
| SMILES | CCC(CC)C(O)CNc1ccc(N)c(OCC2CC2)n1 |
| InChI | InChI=1S/C16H27N3O2/c1-3-12(4-2)14(20)9-18-15-8-7-13(17)16(19-15)21-10-11-5-6-11/h7-8,11-12,14,20H,3-6,9-10,17H2,1-2H3,(H,18,19) |
| InChIKey | QRWPQBPGEAGIGV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |