C15H25FN2O3 — CID 83111321
1-(5-fluoro-2-pyridinyl)-3-[2-methoxyethyl(3-methoxypropyl)amino]propan-1-ol (PubChem CID 83111321) has the molecular formula C15H25FN2O3 and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[2-methoxyethyl(3-methoxypropyl)amino]propan-1-ol.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[2-methoxyethyl(3-methoxypropyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 83111321 |
| Molecular Formula | C15H25FN2O3 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[2-methoxyethyl(3-methoxypropyl)amino]propan-1-ol |
| SMILES | COCCCN(CCOC)CCC(O)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H25FN2O3/c1-20-10-3-7-18(9-11-21-2)8-6-15(19)14-5-4-13(16)12-17-14/h4-5,12,15,19H,3,6-11H2,1-2H3 |
| InChIKey | ABRRMLJLAZUTLN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|