C11H22N4O4 — CID 83112363
2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]-2-ethylbutanoic acid (PubChem CID 83112363) has the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 83112363 |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)NCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H22N4O4/c1-3-11(4-2,8(16)17)7-15-10(19)14-6-5-13-9(12)18/h3-7H2,1-2H3,(H,16,17)(H3,12,13,18)(H2,14,15,19) |
| InChIKey | ZYRIHVKTRATIPT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|