C9H18N4O — CID 83112523
3-[2-(2-iminopyrrolidin-1-yl)ethyl]-1,1-dimethylurea (PubChem CID 83112523) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-[2-(2-iminopyrrolidin-1-yl)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(2-iminopyrrolidin-1-yl)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83112523 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 3-[2-(2-iminopyrrolidin-1-yl)ethyl]-1,1-dimethylurea |
| SMILES | [H]/N=C1\CCCN1CCNC(=O)N(C)C |
| InChI | InChI=1S/C9H18N4O/c1-12(2)9(14)11-5-7-13-6-3-4-8(13)10/h10H,3-7H2,1-2H3,(H,11,14)/b10-8+ |
| InChIKey | UOTJONCHNWROES-CSKARUKUSA-N |
| XLogP | 0.33 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|