C11H20N6O3 — CID 83112782
2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]ethylurea (PubChem CID 83112782) has the molecular formula C11H20N6O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]ethylurea.
| Compound Name | 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83112782 |
| Molecular Formula | C11H20N6O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]ethylurea |
| SMILES | CCCn1c(N)c(NCCNC(N)=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H20N6O3/c1-3-6-17-8(12)7(9(18)16(2)11(17)20)14-4-5-15-10(13)19/h14H,3-6,12H2,1-2H3,(H3,13,15,19) |
| InChIKey | BINLZVVXPRQOFY-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|