About 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea
3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83112926) has the molecular formula C13H20ClN5O
and a molecular weight of 297.79 g/mol. Its IUPAC name is 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| PubChem CID | 83112926 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1NCCNC(=O)N(C)C |
| InChI | InChI=1S/C13H20ClN5O/c1-8-10(14)17-12(9-4-5-9)18-11(8)15-6-7-16-13(20)19(2)3/h9H,4-7H2,1-3H3,(H,16,20)(H,15,17,18) |
| InChIKey | MVLBPYWOAFELOU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (CID 83112926) is 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea is Cc1c(Cl)nc(C2CC2)nc1NCCNC(=O)N(C)C.
What is the InChIKey of 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
The InChIKey is MVLBPYWOAFELOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN5O/c1-8-10(14)17-12(9-4-5-9)18-11(8)15-6-7-16-13(20)19(2)3/h9H,4-7H2,1-3H3,(H,16,20)(H,15,17,18).
What are the key properties of 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea has a molecular weight of 297.79 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea is sourced from PubChem (CID 83112926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).