C12H21N7O — CID 83118304
3-[2-[(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83118304) has the molecular formula C12H21N7O and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-[2-[(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83118304 |
| Molecular Formula | C12H21N7O |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-[2-[(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1cc(NN)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H21N7O/c1-19(2)12(20)15-6-5-14-9-7-10(18-13)17-11(16-9)8-3-4-8/h7-8H,3-6,13H2,1-2H3,(H,15,20)(H2,14,16,17,18) |
| InChIKey | WMPSOYOHHHKCPC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|