C11H18ClN5O — CID 83113578
3-[2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83113578) has the molecular formula C11H18ClN5O and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-[2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83113578 |
| Molecular Formula | C11H18ClN5O |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-[2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CCc1nc(Cl)cc(NCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C11H18ClN5O/c1-4-9-15-8(12)7-10(16-9)13-5-6-14-11(18)17(2)3/h7H,4-6H2,1-3H3,(H,14,18)(H,13,15,16) |
| InChIKey | ZVTZNLIQRZQHBT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|