C11H17N3OS — CID 83113958
2-(2-phenylsulfanylethylamino)ethylurea (PubChem CID 83113958) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethylamino)ethylurea.
| Compound Name | 2-(2-phenylsulfanylethylamino)ethylurea |
|---|---|
| PubChem CID | 83113958 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(2-phenylsulfanylethylamino)ethylurea |
| SMILES | NC(=O)NCCNCCSc1ccccc1 |
| InChI | InChI=1S/C11H17N3OS/c12-11(15)14-7-6-13-8-9-16-10-4-2-1-3-5-10/h1-5,13H,6-9H2,(H3,12,14,15) |
| InChIKey | HNKJQSOCUHKOGY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|