C11H18N4O3S2 — CID 83116775
2-[2-(2-aminophenyl)sulfanylethylsulfonylamino]ethylurea (PubChem CID 83116775) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[2-(2-aminophenyl)sulfanylethylsulfonylamino]ethylurea.
| Compound Name | 2-[2-(2-aminophenyl)sulfanylethylsulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83116775 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[2-(2-aminophenyl)sulfanylethylsulfonylamino]ethylurea |
| SMILES | NC(=O)NCCNS(=O)(=O)CCSc1ccccc1N |
| InChI | InChI=1S/C11H18N4O3S2/c12-9-3-1-2-4-10(9)19-7-8-20(17,18)15-6-5-14-11(13)16/h1-4,15H,5-8,12H2,(H3,13,14,16) |
| InChIKey | OXRWHAYLHQHKQV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|