C14H20N4O — CID 83116828
3-[2-[1-(3-cyanophenyl)ethylamino]ethyl]-1,1-dimethylurea (PubChem CID 83116828) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[2-[1-(3-cyanophenyl)ethylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[1-(3-cyanophenyl)ethylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116828 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-[2-[1-(3-cyanophenyl)ethylamino]ethyl]-1,1-dimethylurea |
| SMILES | CC(NCCNC(=O)N(C)C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H20N4O/c1-11(13-6-4-5-12(9-13)10-15)16-7-8-17-14(19)18(2)3/h4-6,9,11,16H,7-8H2,1-3H3,(H,17,19) |
| InChIKey | NPEVUYQFZVRFGC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|