C12H23N5O — CID 83116947
1,1-dimethyl-3-[2-[(3-propylimidazol-4-yl)methylamino]ethyl]urea (PubChem CID 83116947) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(3-propylimidazol-4-yl)methylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(3-propylimidazol-4-yl)methylamino]ethyl]urea |
|---|---|
| PubChem CID | 83116947 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(3-propylimidazol-4-yl)methylamino]ethyl]urea |
| SMILES | CCCn1cncc1CNCCNC(=O)N(C)C |
| InChI | InChI=1S/C12H23N5O/c1-4-7-17-10-14-9-11(17)8-13-5-6-15-12(18)16(2)3/h9-10,13H,4-8H2,1-3H3,(H,15,18) |
| InChIKey | ADSXTNNVUNNIBH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|