C11H21N5O — CID 83121189
3-[2-[(2,5-dimethylpyrazol-3-yl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83121189) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-[2-[(2,5-dimethylpyrazol-3-yl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2,5-dimethylpyrazol-3-yl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121189 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-[2-[(2,5-dimethylpyrazol-3-yl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | Cc1cc(CNCCNC(=O)N(C)C)n(C)n1 |
| InChI | InChI=1S/C11H21N5O/c1-9-7-10(16(4)14-9)8-12-5-6-13-11(17)15(2)3/h7,12H,5-6,8H2,1-4H3,(H,13,17) |
| InChIKey | WMKWXYGOVRAZOF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|