C12H22ClN5O — CID 83120996
3-[2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83120996) has the molecular formula C12H22ClN5O and a molecular weight of 287.80 g/mol. Its IUPAC name is 3-[2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83120996 |
| Molecular Formula | C12H22ClN5O |
| Molecular Weight | 287.80 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CCn1nc(C)c(Cl)c1CNCCNC(=O)N(C)C |
| InChI | InChI=1S/C12H22ClN5O/c1-5-18-10(11(13)9(2)16-18)8-14-6-7-15-12(19)17(3)4/h14H,5-8H2,1-4H3,(H,15,19) |
| InChIKey | DSYZAXLKGHBGPR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.80 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|