C12H19ClF3N3 — CID 115518676
N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115518676) has the molecular formula C12H19ClF3N3 and a molecular weight of 297.75 g/mol. Its IUPAC name is N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115518676 |
| Molecular Formula | C12H19ClF3N3 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | CCn1nc(C)c(Cl)c1CNCCCCC(F)(F)F |
| InChI | InChI=1S/C12H19ClF3N3/c1-3-19-10(11(13)9(2)18-19)8-17-7-5-4-6-12(14,15)16/h17H,3-8H2,1-2H3 |
| InChIKey | RMYXUACSHPKFTI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|