C13H17FN2O — CID 83125838
3-[cyclopropylmethyl(methyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one (PubChem CID 83125838) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-[cyclopropylmethyl(methyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one.
| Compound Name | 3-[cyclopropylmethyl(methyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 83125838 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-[cyclopropylmethyl(methyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one |
| SMILES | CN(CCC(=O)c1ccc(F)cn1)CC1CC1 |
| InChI | InChI=1S/C13H17FN2O/c1-16(9-10-2-3-10)7-6-13(17)12-5-4-11(14)8-15-12/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | AASIBZVYZHNSQU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |