C12H18FN3S — CID 83125999
1-(5-fluoro-2-pyridinyl)-3-thiomorpholin-4-ylpropan-1-amine (PubChem CID 83125999) has the molecular formula C12H18FN3S and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-thiomorpholin-4-ylpropan-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-thiomorpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 83125999 |
| Molecular Formula | C12H18FN3S |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-thiomorpholin-4-ylpropan-1-amine |
| SMILES | NC(CCN1CCSCC1)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H18FN3S/c13-10-1-2-12(15-9-10)11(14)3-4-16-5-7-17-8-6-16/h1-2,9,11H,3-8,14H2 |
| InChIKey | NPCFWXVHEOYAEY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |