C12H15BrF3NO — CID 83133335
2-(4-bromo-3-methylphenoxy)-1,1,1-trifluoropentan-3-amine (PubChem CID 83133335) has the molecular formula C12H15BrF3NO and a molecular weight of 326.16 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-1,1,1-trifluoropentan-3-amine.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-1,1,1-trifluoropentan-3-amine |
|---|---|
| PubChem CID | 83133335 |
| Molecular Formula | C12H15BrF3NO |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-1,1,1-trifluoropentan-3-amine |
| SMILES | CCC(N)C(Oc1ccc(Br)c(C)c1)C(F)(F)F |
| InChI | InChI=1S/C12H15BrF3NO/c1-3-10(17)11(12(14,15)16)18-8-4-5-9(13)7(2)6-8/h4-6,10-11H,3,17H2,1-2H3 |
| InChIKey | AOMXOEAXPJLPFK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |