C17H20N2O2 — CID 83137368
3-[4-[(2-ethyl-5-methylpyrazol-3-yl)methoxy]-2-methylphenyl]prop-2-yn-1-ol (PubChem CID 83137368) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[4-[(2-ethyl-5-methylpyrazol-3-yl)methoxy]-2-methylphenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[(2-ethyl-5-methylpyrazol-3-yl)methoxy]-2-methylphenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 83137368 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-[4-[(2-ethyl-5-methylpyrazol-3-yl)methoxy]-2-methylphenyl]prop-2-yn-1-ol |
| SMILES | CCn1nc(C)cc1COc1ccc(C#CCO)c(C)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-4-19-16(11-14(3)18-19)12-21-17-8-7-15(6-5-9-20)13(2)10-17/h7-8,10-11,20H,4,9,12H2,1-3H3 |
| InChIKey | YVAHNIBWGRYCMX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|