C15H20N2OS2 — CID 83137418
N-(2-amino-1-phenyl-2-sulfanylideneethyl)-2-(thian-4-yl)acetamide (PubChem CID 83137418) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-(2-amino-1-phenyl-2-sulfanylideneethyl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(2-amino-1-phenyl-2-sulfanylideneethyl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 83137418 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-(2-amino-1-phenyl-2-sulfanylideneethyl)-2-(thian-4-yl)acetamide |
| SMILES | NC(=S)C(NC(=O)CC1CCSCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2OS2/c16-15(19)14(12-4-2-1-3-5-12)17-13(18)10-11-6-8-20-9-7-11/h1-5,11,14H,6-10H2,(H2,16,19)(H,17,18) |
| InChIKey | CUHSOMCABWFLSM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|