1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid

C13H26N2O4S — CID 83143229

IUPAC1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid
SMILESCC(CNS(=O)(=O)N1CCCC(C(=O)O)C1)C(C)(C)C
InChIInChI=1S/C13H26N2O4S/c1-10(13(2,3)4)8-14-20(18,19)15-7-5-6-11(9-15)12(16)17/h10-11,14H,5-9H2,1-4H3,(H,16,17)
InChIKeyZTPNSTDPFSAFKF-UHFFFAOYSA-N
MW306.43 g/mol
LogP1.30
Rot. Bonds5

About 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid

1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid (PubChem CID 83143229) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid
PubChem CID83143229
Molecular FormulaC13H26N2O4S
Molecular Weight306.43 g/mol
Exact Mass306.16
IUPAC Name1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid
SMILESCC(CNS(=O)(=O)N1CCCC(C(=O)O)C1)C(C)(C)C
InChIInChI=1S/C13H26N2O4S/c1-10(13(2,3)4)8-14-20(18,19)15-7-5-6-11(9-15)12(16)17/h10-11,14H,5-9H2,1-4H3,(H,16,17)
InChIKeyZTPNSTDPFSAFKF-UHFFFAOYSA-N
XLogP1.30
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.43
LogP ≤ 51.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid (CID 83143229) is 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid is CC(CNS(=O)(=O)N1CCCC(C(=O)O)C1)C(C)(C)C.
What is the InChIKey of 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid?
The InChIKey is ZTPNSTDPFSAFKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4S/c1-10(13(2,3)4)8-14-20(18,19)15-7-5-6-11(9-15)12(16)17/h10-11,14H,5-9H2,1-4H3,(H,16,17).
What are the key properties of 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid?
1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid has a molecular weight of 306.43 g/mol, XLogP of 1.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3,3-trimethylbutylsulfamoyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 83143229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).