C13H29N3O2S — CID 83144360
2-piperazin-1-yl-N-(2,3,3-trimethylbutyl)ethanesulfonamide (PubChem CID 83144360) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-(2,3,3-trimethylbutyl)ethanesulfonamide.
| Compound Name | 2-piperazin-1-yl-N-(2,3,3-trimethylbutyl)ethanesulfonamide |
|---|---|
| PubChem CID | 83144360 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-piperazin-1-yl-N-(2,3,3-trimethylbutyl)ethanesulfonamide |
| SMILES | CC(CNS(=O)(=O)CCN1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C13H29N3O2S/c1-12(13(2,3)4)11-15-19(17,18)10-9-16-7-5-14-6-8-16/h12,14-15H,5-11H2,1-4H3 |
| InChIKey | WUDUCNLBGAEHJL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |