C11H12BrN5O2 — CID 83145198
[4-(4-bromo-3-methylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 83145198) has the molecular formula C11H12BrN5O2 and a molecular weight of 326.15 g/mol. Its IUPAC name is [4-(4-bromo-3-methylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-bromo-3-methylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 83145198 |
| Molecular Formula | C11H12BrN5O2 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | [4-(4-bromo-3-methylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(Oc2ccc(Br)c(C)c2)n1 |
| InChI | InChI=1S/C11H12BrN5O2/c1-6-5-7(3-4-8(6)12)19-11-15-9(17-13)14-10(16-11)18-2/h3-5H,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | ITIZURRAAUYOAN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|