C12H15N5O2 — CID 80916071
[4-(3,4-dimethylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80916071) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is [4-(3,4-dimethylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3,4-dimethylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80916071 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [4-(3,4-dimethylphenoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(Oc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C12H15N5O2/c1-7-4-5-9(6-8(7)2)19-12-15-10(17-13)14-11(16-12)18-3/h4-6H,13H2,1-3H3,(H,14,15,16,17) |
| InChIKey | JFNAMXFMOMHXQA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|