C15H23FN2O2 — CID 83146930
methyl 2-amino-4-fluoro-5-(2,3,3-trimethylbutylamino)benzoate (PubChem CID 83146930) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 2-amino-4-fluoro-5-(2,3,3-trimethylbutylamino)benzoate.
| Compound Name | methyl 2-amino-4-fluoro-5-(2,3,3-trimethylbutylamino)benzoate |
|---|---|
| PubChem CID | 83146930 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl 2-amino-4-fluoro-5-(2,3,3-trimethylbutylamino)benzoate |
| SMILES | COC(=O)c1cc(NCC(C)C(C)(C)C)c(F)cc1N |
| InChI | InChI=1S/C15H23FN2O2/c1-9(15(2,3)4)8-18-13-6-10(14(19)20-5)12(17)7-11(13)16/h6-7,9,18H,8,17H2,1-5H3 |
| InChIKey | LXIZITIHWCXCSE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|