C16H30ClN3O — CID 83149836
2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine (PubChem CID 83149836) has the molecular formula C16H30ClN3O and a molecular weight of 315.89 g/mol. Its IUPAC name is 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 83149836 |
| Molecular Formula | C16H30ClN3O |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine |
| SMILES | CCn1nc(C)c(Cl)c1CC(C)(CNCCOC)C(C)C |
| InChI | InChI=1S/C16H30ClN3O/c1-7-20-14(15(17)13(4)19-20)10-16(5,12(2)3)11-18-8-9-21-6/h12,18H,7-11H2,1-6H3 |
| InChIKey | ZNVXHOOYDBASLB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|