C13H14ClN3OS — CID 83152765
N-[3-[1-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]phenyl]acetamide (PubChem CID 83152765) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is N-[3-[1-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 83152765 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-[3-[1-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(C)Nc2nc(Cl)cs2)c1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-8(15-13-17-12(14)7-19-13)10-4-3-5-11(6-10)16-9(2)18/h3-8H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | QAZUCPCHERGZIG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |