C8H11ClN2O2S — CID 83153680
4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid (PubChem CID 83153680) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid.
| Compound Name | 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 83153680 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)c1nc(Cl)cs1 |
| InChI | InChI=1S/C8H11ClN2O2S/c1-11(4-2-3-7(12)13)8-10-6(9)5-14-8/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | BLIBLYRPFWHYDQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |