4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid

C8H11ClN2O2S — CID 83153680

IUPAC4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid
SMILESCN(CCCC(=O)O)c1nc(Cl)cs1
InChIInChI=1S/C8H11ClN2O2S/c1-11(4-2-3-7(12)13)8-10-6(9)5-14-8/h5H,2-4H2,1H3,(H,12,13)
InChIKeyBLIBLYRPFWHYDQ-UHFFFAOYSA-N
MW234.71 g/mol
LogP2.10
Rot. Bonds5

About 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid

4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid (PubChem CID 83153680) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid.

Molecular Properties

Compound Name4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid
PubChem CID83153680
Molecular FormulaC8H11ClN2O2S
Molecular Weight234.71 g/mol
Exact Mass234.02
IUPAC Name4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid
SMILESCN(CCCC(=O)O)c1nc(Cl)cs1
InChIInChI=1S/C8H11ClN2O2S/c1-11(4-2-3-7(12)13)8-10-6(9)5-14-8/h5H,2-4H2,1H3,(H,12,13)
InChIKeyBLIBLYRPFWHYDQ-UHFFFAOYSA-N
XLogP2.10
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.71
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid?
The IUPAC name of 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid (CID 83153680) is 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid.
What is the SMILES notation for 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid?
The canonical SMILES for 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid is CN(CCCC(=O)O)c1nc(Cl)cs1.
What is the InChIKey of 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid?
The InChIKey is BLIBLYRPFWHYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O2S/c1-11(4-2-3-7(12)13)8-10-6(9)5-14-8/h5H,2-4H2,1H3,(H,12,13).
What are the key properties of 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid?
4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid has a molecular weight of 234.71 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-1,3-thiazol-2-yl)-methylamino]butanoic acid is sourced from PubChem (CID 83153680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).