C10H18N2OS — CID 83154806
N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-2-cyclopropylpropanamide (PubChem CID 83154806) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-2-cyclopropylpropanamide.
| Compound Name | N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-2-cyclopropylpropanamide |
|---|---|
| PubChem CID | 83154806 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-2-cyclopropylpropanamide |
| SMILES | CC(C(=O)NC(C)(C)C(N)=S)C1CC1 |
| InChI | InChI=1S/C10H18N2OS/c1-6(7-4-5-7)8(13)12-10(2,3)9(11)14/h6-7H,4-5H2,1-3H3,(H2,11,14)(H,12,13) |
| InChIKey | GFARSVPIQPQFNT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|