C11H8ClNO4S — CID 83155338
2-[(4-chloro-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid (PubChem CID 83155338) has the molecular formula C11H8ClNO4S and a molecular weight of 285.71 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid.
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 83155338 |
| Molecular Formula | C11H8ClNO4S |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Oc2nc(Cl)cs2)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H8ClNO4S/c1-16-6-2-3-8(7(4-6)10(14)15)17-11-13-9(12)5-18-11/h2-5H,1H3,(H,14,15) |
| InChIKey | QIHJHVVZRBGCDX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |