C13H13NO4S — CID 62961025
2-[(4-ethyl-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid (PubChem CID 62961025) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[(4-ethyl-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid.
| Compound Name | 2-[(4-ethyl-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 62961025 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-[(4-ethyl-1,3-thiazol-2-yl)oxy]-5-methoxybenzoic acid |
| SMILES | CCc1csc(Oc2ccc(OC)cc2C(=O)O)n1 |
| InChI | InChI=1S/C13H13NO4S/c1-3-8-7-19-13(14-8)18-11-5-4-9(17-2)6-10(11)12(15)16/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | MRBMIRGBJFBVIO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |