C10H16ClN3S — CID 83156155
4-chloro-N-(2-piperidin-3-ylethyl)-1,3-thiazol-2-amine (PubChem CID 83156155) has the molecular formula C10H16ClN3S and a molecular weight of 245.78 g/mol. Its IUPAC name is 4-chloro-N-(2-piperidin-3-ylethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(2-piperidin-3-ylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83156155 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-chloro-N-(2-piperidin-3-ylethyl)-1,3-thiazol-2-amine |
| SMILES | Clc1csc(NCCC2CCCNC2)n1 |
| InChI | InChI=1S/C10H16ClN3S/c11-9-7-15-10(14-9)13-5-3-8-2-1-4-12-6-8/h7-8,12H,1-6H2,(H,13,14) |
| InChIKey | VFJOBMKUJQKTMI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |