C10H15ClN2OS — CID 83153384
2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 83153384) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is 2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 83153384 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CNc1nc(Cl)cs1 |
| InChI | InChI=1S/C10H15ClN2OS/c11-9-6-15-10(13-9)12-5-7-3-1-2-4-8(7)14/h6-8,14H,1-5H2,(H,12,13) |
| InChIKey | BIRKOCAJDLVXIR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |