C15H23NO2 — CID 83157735
(NE)-N-[1-[5-methyl-2-(4-methylpentoxy)phenyl]ethylidene]hydroxylamine (PubChem CID 83157735) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (NE)-N-[1-[5-methyl-2-(4-methylpentoxy)phenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[5-methyl-2-(4-methylpentoxy)phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 83157735 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (NE)-N-[1-[5-methyl-2-(4-methylpentoxy)phenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1cc(C)ccc1OCCCC(C)C |
| InChI | InChI=1S/C15H23NO2/c1-11(2)6-5-9-18-15-8-7-12(3)10-14(15)13(4)16-17/h7-8,10-11,17H,5-6,9H2,1-4H3/b16-13+ |
| InChIKey | PIYZYQUTVRNZLO-DTQAZKPQSA-N |
| XLogP | 4.01 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|