C14H21NO4S — CID 106725527
(NE)-N-[1-[5-methyl-2-(2-propan-2-ylsulfonylethoxy)phenyl]ethylidene]hydroxylamine (PubChem CID 106725527) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (NE)-N-[1-[5-methyl-2-(2-propan-2-ylsulfonylethoxy)phenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[5-methyl-2-(2-propan-2-ylsulfonylethoxy)phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 106725527 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (NE)-N-[1-[5-methyl-2-(2-propan-2-ylsulfonylethoxy)phenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1cc(C)ccc1OCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C14H21NO4S/c1-10(2)20(17,18)8-7-19-14-6-5-11(3)9-13(14)12(4)15-16/h5-6,9-10,16H,7-8H2,1-4H3/b15-12+ |
| InChIKey | NBFNFBHLFBRXRD-NTCAYCPXSA-N |
| XLogP | 2.40 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|