C10H6ClF2NS — CID 83158898
4-chloro-2-(2,6-difluoro-3-methylphenyl)-1,3-thiazole (PubChem CID 83158898) has the molecular formula C10H6ClF2NS and a molecular weight of 245.68 g/mol. Its IUPAC name is 4-chloro-2-(2,6-difluoro-3-methylphenyl)-1,3-thiazole.
| Compound Name | 4-chloro-2-(2,6-difluoro-3-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83158898 |
| Molecular Formula | C10H6ClF2NS |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 4-chloro-2-(2,6-difluoro-3-methylphenyl)-1,3-thiazole |
| SMILES | Cc1ccc(F)c(-c2nc(Cl)cs2)c1F |
| InChI | InChI=1S/C10H6ClF2NS/c1-5-2-3-6(12)8(9(5)13)10-14-7(11)4-15-10/h2-4H,1H3 |
| InChIKey | ZWWDNPZQXPELGQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |