C15H11Br2NO2S — CID 83164049
(4,5-dibromothiophen-2-yl)-(4-ethoxy-1H-indol-3-yl)methanone (PubChem CID 83164049) has the molecular formula C15H11Br2NO2S and a molecular weight of 429.13 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(4-ethoxy-1H-indol-3-yl)methanone.
| Compound Name | (4,5-dibromothiophen-2-yl)-(4-ethoxy-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 83164049 |
| Molecular Formula | C15H11Br2NO2S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(4-ethoxy-1H-indol-3-yl)methanone |
| SMILES | CCOc1cccc2[nH]cc(C(=O)c3cc(Br)c(Br)s3)c12 |
| InChI | InChI=1S/C15H11Br2NO2S/c1-2-20-11-5-3-4-10-13(11)8(7-18-10)14(19)12-6-9(16)15(17)21-12/h3-7,18H,2H2,1H3 |
| InChIKey | PFLPTMLLUWZZFA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |