C15H11Br2NOS — CID 80537318
(4,5-dibromothiophen-2-yl)-(7-ethyl-1H-indol-3-yl)methanone (PubChem CID 80537318) has the molecular formula C15H11Br2NOS and a molecular weight of 413.13 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(7-ethyl-1H-indol-3-yl)methanone.
| Compound Name | (4,5-dibromothiophen-2-yl)-(7-ethyl-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 80537318 |
| Molecular Formula | C15H11Br2NOS |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(7-ethyl-1H-indol-3-yl)methanone |
| SMILES | CCc1cccc2c(C(=O)c3cc(Br)c(Br)s3)c[nH]c12 |
| InChI | InChI=1S/C15H11Br2NOS/c1-2-8-4-3-5-9-10(7-18-13(8)9)14(19)12-6-11(16)15(17)20-12/h3-7,18H,2H2,1H3 |
| InChIKey | KOKAJIOTAOJXII-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |