C17H13Br2NO — CID 107979602
(3,5-dibromophenyl)-(7-ethyl-1H-indol-3-yl)methanone (PubChem CID 107979602) has the molecular formula C17H13Br2NO and a molecular weight of 407.11 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(7-ethyl-1H-indol-3-yl)methanone.
| Compound Name | (3,5-dibromophenyl)-(7-ethyl-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 107979602 |
| Molecular Formula | C17H13Br2NO |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | (3,5-dibromophenyl)-(7-ethyl-1H-indol-3-yl)methanone |
| SMILES | CCc1cccc2c(C(=O)c3cc(Br)cc(Br)c3)c[nH]c12 |
| InChI | InChI=1S/C17H13Br2NO/c1-2-10-4-3-5-14-15(9-20-16(10)14)17(21)11-6-12(18)8-13(19)7-11/h3-9,20H,2H2,1H3 |
| InChIKey | MTOODUCUTZVIRB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |