C12H11Cl2NS — CID 83173458
2-[(2,4-dichlorophenyl)methyl]thiolane-2-carbonitrile (PubChem CID 83173458) has the molecular formula C12H11Cl2NS and a molecular weight of 272.20 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]thiolane-2-carbonitrile.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]thiolane-2-carbonitrile |
|---|---|
| PubChem CID | 83173458 |
| Molecular Formula | C12H11Cl2NS |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]thiolane-2-carbonitrile |
| SMILES | N#CC1(Cc2ccc(Cl)cc2Cl)CCCS1 |
| InChI | InChI=1S/C12H11Cl2NS/c13-10-3-2-9(11(14)6-10)7-12(8-15)4-1-5-16-12/h2-3,6H,1,4-5,7H2 |
| InChIKey | VUNINCQTSMYJEJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |