C10H11ClO2S2 — CID 83173851
2-[(5-chlorothiophen-2-yl)methyl]thiolane-2-carboxylic acid (PubChem CID 83173851) has the molecular formula C10H11ClO2S2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl]thiolane-2-carboxylic acid.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl]thiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 83173851 |
| Molecular Formula | C10H11ClO2S2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl]thiolane-2-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Cl)s2)CCCS1 |
| InChI | InChI=1S/C10H11ClO2S2/c11-8-3-2-7(15-8)6-10(9(12)13)4-1-5-14-10/h2-3H,1,4-6H2,(H,12,13) |
| InChIKey | KSNUVIUFUDFDAO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |